C26H27N3O — CID 177414834
N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]benzamide (PubChem CID 177414834) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]benzamide.
| Compound Name | N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]benzamide |
|---|---|
| PubChem CID | 177414834 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]benzamide |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](NC(=O)c1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H27N3O/c1-2-18-17-29-15-13-20(18)16-24(29)25(28-26(30)19-8-4-3-5-9-19)22-12-14-27-23-11-7-6-10-21(22)23/h2-12,14,18,20,24-25H,1,13,15-17H2,(H,28,30)/t18-,20-,24-,25-/m0/s1 |
| InChIKey | LUDJVVHYLPTLOW-IYNDAXALSA-N |
| XLogP | 4.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|