C27H25ClF3N3O — CID 68702720
2-chloro-N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(trifluoromethyl)benzamide (PubChem CID 68702720) has the molecular formula C27H25ClF3N3O and a molecular weight of 499.96 g/mol. Its IUPAC name is 2-chloro-N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 68702720 |
| Molecular Formula | C27H25ClF3N3O |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 2-chloro-N-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-(trifluoromethyl)benzamide |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H](NC(=O)c1cccc(C(F)(F)F)c1Cl)c1ccnc2ccccc12 |
| InChI | InChI=1S/C27H25ClF3N3O/c1-2-16-15-34-13-11-17(16)14-23(34)25(19-10-12-32-22-9-4-3-6-18(19)22)33-26(35)20-7-5-8-21(24(20)28)27(29,30)31/h2-10,12,16-17,23,25H,1,11,13-15H2,(H,33,35)/t16?,17?,23-,25-/m0/s1 |
| InChIKey | WLMWYHBIMWQATN-AYCGSUNYSA-N |
| XLogP | 6.27 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|