C24H26N4O2S — CID 177479575
N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]pyridine-2-sulfonamide (PubChem CID 177479575) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]pyridine-2-sulfonamide.
| Compound Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 177479575 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]pyridine-2-sulfonamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NS(=O)(=O)c1ccccn1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C24H26N4O2S/c1-2-17-16-28-14-11-18(17)15-22(28)24(27-31(29,30)23-9-5-6-12-26-23)20-10-13-25-21-8-4-3-7-19(20)21/h2-10,12-13,17-18,22,24,27H,1,11,14-16H2/t17?,18?,22?,24-/m0/s1 |
| InChIKey | SZEWGJAUODLDPM-ADCYACJBSA-N |
| XLogP | 3.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|