C26H28N4S — CID 101464009
1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-phenylthiourea (PubChem CID 101464009) has the molecular formula C26H28N4S and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-phenylthiourea.
| Compound Name | 1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 101464009 |
| Molecular Formula | C26H28N4S |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-phenylthiourea |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H](NC(=S)Nc1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H28N4S/c1-2-18-17-30-15-13-19(18)16-24(30)25(29-26(31)28-20-8-4-3-5-9-20)22-12-14-27-23-11-7-6-10-21(22)23/h2-12,14,18-19,24-25H,1,13,15-17H2,(H2,28,29,31)/t18?,19?,24-,25-/m0/s1 |
| InChIKey | MHMLFGCRXLQNAV-UOIJDSNFSA-N |
| XLogP | 5.16 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|