C29H34N4S — CID 134530671
1-(3,5-dimethylphenyl)-3-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methylquinolin-4-yl)methyl]thiourea (PubChem CID 134530671) has the molecular formula C29H34N4S and a molecular weight of 470.69 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methylquinolin-4-yl)methyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methylquinolin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 134530671 |
| Molecular Formula | C29H34N4S |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methylquinolin-4-yl)methyl]thiourea |
| SMILES | C=CC1CN2CCC1CC2[C@H](NC(=S)Nc1cc(C)cc(C)c1)c1ccnc2ccc(C)cc12 |
| InChI | InChI=1S/C29H34N4S/c1-5-21-17-33-11-9-22(21)16-27(33)28(24-8-10-30-26-7-6-18(2)15-25(24)26)32-29(34)31-23-13-19(3)12-20(4)14-23/h5-8,10,12-15,21-22,27-28H,1,9,11,16-17H2,2-4H3,(H2,31,32,34)/t21?,22?,27?,28-/m1/s1 |
| InChIKey | QMFUOIKSHFHNGQ-WCIKNARASA-N |
| XLogP | 6.08 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|