C29H31F3N4OS — CID 88554290
1-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 88554290) has the molecular formula C29H31F3N4OS and a molecular weight of 540.66 g/mol. Its IUPAC name is 1-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 88554290 |
| Molecular Formula | C29H31F3N4OS |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 1-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NC(=S)Nc1cc(C)cc(C(F)(F)F)c1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H31F3N4OS/c1-4-18-16-36-10-8-19(18)13-26(36)27(23-7-9-33-25-6-5-22(37-3)15-24(23)25)35-28(38)34-21-12-17(2)11-20(14-21)29(30,31)32/h4-7,9,11-12,14-15,18-19,26-27H,1,8,10,13,16H2,2-3H3,(H2,34,35,38)/t18?,19?,26?,27-/m0/s1 |
| InChIKey | WLBSFTXMHGVBSD-GKRHSLLRSA-N |
| XLogP | 6.49 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|