C30H34F6N4OS — CID 91146558
1-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[7,7,7-trifluoro-6-methyl-4-(trifluoromethyl)hepta-3,5-dien-2-yl]thiourea (PubChem CID 91146558) has the molecular formula C30H34F6N4OS and a molecular weight of 612.68 g/mol. Its IUPAC name is 1-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[7,7,7-trifluoro-6-methyl-4-(trifluoromethyl)hepta-3,5-dien-2-yl]thiourea.
| Compound Name | 1-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[7,7,7-trifluoro-6-methyl-4-(trifluoromethyl)hepta-3,5-dien-2-yl]thiourea |
|---|---|
| PubChem CID | 91146558 |
| Molecular Formula | C30H34F6N4OS |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | 1-[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[7,7,7-trifluoro-6-methyl-4-(trifluoromethyl)hepta-3,5-dien-2-yl]thiourea |
| SMILES | C=CC1CN2CCC1CC2C(NC(=S)NC(C)C=C(C=C(C)C(F)(F)F)C(F)(F)F)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C30H34F6N4OS/c1-5-19-16-40-11-9-20(19)14-26(40)27(23-8-10-37-25-7-6-22(41-4)15-24(23)25)39-28(42)38-18(3)13-21(30(34,35)36)12-17(2)29(31,32)33/h5-8,10,12-13,15,18-20,26-27H,1,9,11,14,16H2,2-4H3,(H2,38,39,42) |
| InChIKey | LZASVNVJKVGCSO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|