C26H35N5OS — CID 155898827
1-[[(4R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-(pyrrolidin-2-ylmethyl)thiourea (PubChem CID 155898827) has the molecular formula C26H35N5OS and a molecular weight of 465.67 g/mol. Its IUPAC name is 1-[[(4R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-(pyrrolidin-2-ylmethyl)thiourea.
| Compound Name | 1-[[(4R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-(pyrrolidin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 155898827 |
| Molecular Formula | C26H35N5OS |
| Molecular Weight | 465.67 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 1-[[(4R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-(pyrrolidin-2-ylmethyl)thiourea |
| SMILES | C=CC1CN2CC[C@@H]1CC2C(NC(=S)NCC1CCCN1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C26H35N5OS/c1-3-17-16-31-12-9-18(17)13-24(31)25(30-26(33)29-15-19-5-4-10-27-19)21-8-11-28-23-7-6-20(32-2)14-22(21)23/h3,6-8,11,14,17-19,24-25,27H,1,4-5,9-10,12-13,15-16H2,2H3,(H2,29,30,33)/t17?,18-,19?,24?,25?/m1/s1 |
| InChIKey | ZYFYXPKCTGTGLB-VRZWTTCCSA-N |
| XLogP | 3.40 |
| TPSA | 61.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|