C28H32N4OS — CID 71474824
1-[(R)-[(2R,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-[(1R)-2-hydroxy-1-phenylethyl]thiourea (PubChem CID 71474824) has the molecular formula C28H32N4OS and a molecular weight of 472.66 g/mol. Its IUPAC name is 1-[(R)-[(2R,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-[(1R)-2-hydroxy-1-phenylethyl]thiourea.
| Compound Name | 1-[(R)-[(2R,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-[(1R)-2-hydroxy-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 71474824 |
| Molecular Formula | C28H32N4OS |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 1-[(R)-[(2R,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]-3-[(1R)-2-hydroxy-1-phenylethyl]thiourea |
| SMILES | C=C[C@@H]1CN2CC[C@@H]1C[C@@H]2[C@H](NC(=S)N[C@@H](CO)c1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C28H32N4OS/c1-2-19-17-32-15-13-21(19)16-26(32)27(23-12-14-29-24-11-7-6-10-22(23)24)31-28(34)30-25(18-33)20-8-4-3-5-9-20/h2-12,14,19,21,25-27,33H,1,13,15-18H2,(H2,30,31,34)/t19-,21-,25+,26-,27-/m1/s1 |
| InChIKey | ZJVMKRYMOMIVSI-ZBCNZHSLSA-N |
| XLogP | 4.37 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|