C26H35N5S — CID 135022129
1-[(1R,2R)-2-aminocyclohexyl]-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]thiourea (PubChem CID 135022129) has the molecular formula C26H35N5S and a molecular weight of 449.67 g/mol. Its IUPAC name is 1-[(1R,2R)-2-aminocyclohexyl]-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]thiourea.
| Compound Name | 1-[(1R,2R)-2-aminocyclohexyl]-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]thiourea |
|---|---|
| PubChem CID | 135022129 |
| Molecular Formula | C26H35N5S |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 1-[(1R,2R)-2-aminocyclohexyl]-3-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]thiourea |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H](NC(=S)N[C@@H]1CCCC[C@H]1N)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H35N5S/c1-2-17-16-31-14-12-18(17)15-24(31)25(20-11-13-28-22-9-5-3-7-19(20)22)30-26(32)29-23-10-6-4-8-21(23)27/h2-3,5,7,9,11,13,17-18,21,23-25H,1,4,6,8,10,12,14-16,27H2,(H2,29,30,32)/t17?,18?,21-,23-,24+,25+/m1/s1 |
| InChIKey | LHDSISASGSUGCB-KMAVAUBPSA-N |
| XLogP | 3.91 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|