C26H30BN3O2 — CID 177488529
[2-[[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]methyl]phenyl]boronic acid (PubChem CID 177488529) has the molecular formula C26H30BN3O2 and a molecular weight of 427.36 g/mol. Its IUPAC name is [2-[[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]methyl]phenyl]boronic acid.
| Compound Name | [2-[[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 177488529 |
| Molecular Formula | C26H30BN3O2 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [2-[[[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]methyl]phenyl]boronic acid |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NCc1ccccc1B(O)O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C26H30BN3O2/c1-2-18-17-30-14-12-19(18)15-25(30)26(22-11-13-28-24-10-6-4-8-21(22)24)29-16-20-7-3-5-9-23(20)27(31)32/h2-11,13,18-19,25-26,29,31-32H,1,12,14-17H2/t18?,19?,25?,26-/m0/s1 |
| InChIKey | SOPDRZYNGJWGPH-PTYYLFHFSA-N |
| XLogP | 2.64 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|