C41H39N5OS — CID 102191762
1-[1-(2-aminonaphthalen-1-yl)naphthalen-2-yl]-3-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]thiourea (PubChem CID 102191762) has the molecular formula C41H39N5OS and a molecular weight of 649.86 g/mol. Its IUPAC name is 1-[1-(2-aminonaphthalen-1-yl)naphthalen-2-yl]-3-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]thiourea.
| Compound Name | 1-[1-(2-aminonaphthalen-1-yl)naphthalen-2-yl]-3-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 102191762 |
| Molecular Formula | C41H39N5OS |
| Molecular Weight | 649.86 g/mol |
| Exact Mass | 649.29 |
| IUPAC Name | 1-[1-(2-aminonaphthalen-1-yl)naphthalen-2-yl]-3-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]thiourea |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](NC(=S)Nc1ccc2ccccc2c1-c1c(N)ccc2ccccc12)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C41H39N5OS/c1-3-25-24-46-21-19-28(25)22-37(46)40(32-18-20-43-35-17-14-29(47-2)23-33(32)35)45-41(48)44-36-16-13-27-9-5-7-11-31(27)39(36)38-30-10-6-4-8-26(30)12-15-34(38)42/h3-18,20,23,25,28,37,40H,1,19,21-22,24,42H2,2H3,(H2,44,45,48)/t25-,28-,37+,40+/m0/s1 |
| InChIKey | FZJHNESXTXJKQZ-KJSIKFADSA-N |
| XLogP | 8.72 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.86 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|