C29H33N3O4S — CID 135028325
O-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(2,4-dimethoxyphenyl)carbamothioate (PubChem CID 135028325) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is O-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(2,4-dimethoxyphenyl)carbamothioate.
| Compound Name | O-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(2,4-dimethoxyphenyl)carbamothioate |
|---|---|
| PubChem CID | 135028325 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | O-[(R)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl] N-(2,4-dimethoxyphenyl)carbamothioate |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@H](OC(=S)Nc1ccc(OC)cc1OC)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H33N3O4S/c1-5-18-17-32-13-11-19(18)14-26(32)28(22-10-12-30-24-8-6-20(33-2)15-23(22)24)36-29(37)31-25-9-7-21(34-3)16-27(25)35-4/h5-10,12,15-16,18-19,26,28H,1,11,13-14,17H2,2-4H3,(H,31,37)/t18-,19?,26-,28+/m0/s1 |
| InChIKey | KXKGMMYSTAPHGP-YIPHAUQDSA-N |
| XLogP | 5.61 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|