C25H25ClN4O — CID 102494355
4-chloro-N-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]pyridine-2-carboxamide (PubChem CID 102494355) has the molecular formula C25H25ClN4O and a molecular weight of 432.96 g/mol. Its IUPAC name is 4-chloro-N-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 102494355 |
| Molecular Formula | C25H25ClN4O |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-chloro-N-[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]pyridine-2-carboxamide |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](NC(=O)c1cc(Cl)ccn1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C25H25ClN4O/c1-2-16-15-30-12-9-17(16)13-23(30)24(29-25(31)22-14-18(26)7-10-28-22)20-8-11-27-21-6-4-3-5-19(20)21/h2-8,10-11,14,16-17,23-24H,1,9,12-13,15H2,(H,29,31)/t16-,17-,23+,24+/m0/s1 |
| InChIKey | DSBNIYFDXWATJG-HHLQZUTDSA-N |
| XLogP | 4.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|