C25H25FN4O — CID 134959549
N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]-6-fluoropyridine-2-carboxamide (PubChem CID 134959549) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]-6-fluoropyridine-2-carboxamide.
| Compound Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 134959549 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]-6-fluoropyridine-2-carboxamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NC(=O)c1cccc(F)n1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C25H25FN4O/c1-2-16-15-30-13-11-17(16)14-22(30)24(29-25(31)21-8-5-9-23(26)28-21)19-10-12-27-20-7-4-3-6-18(19)20/h2-10,12,16-17,22,24H,1,11,13-15H2,(H,29,31)/t16?,17?,22?,24-/m0/s1 |
| InChIKey | HZGXEBQYVAQICY-AXNWUPBJSA-N |
| XLogP | 4.14 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|