C44H47N4O2P — CID 162415114
2-diphenylphosphanyl-N-[(2R)-1-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide (PubChem CID 162415114) has the molecular formula C44H47N4O2P and a molecular weight of 694.86 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N-[(2R)-1-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-diphenylphosphanyl-N-[(2R)-1-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 162415114 |
| Molecular Formula | C44H47N4O2P |
| Molecular Weight | 694.86 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | 2-diphenylphosphanyl-N-[(2R)-1-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]benzamide |
| SMILES | C=CC1CN2CCC1CC2[C@H](NC(=O)[C@H](NC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)C(C)(C)C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C44H47N4O2P/c1-5-30-29-48-27-25-31(30)28-38(48)40(35-24-26-45-37-22-14-12-20-34(35)37)46-43(50)41(44(2,3)4)47-42(49)36-21-13-15-23-39(36)51(32-16-8-6-9-17-32)33-18-10-7-11-19-33/h5-24,26,30-31,38,40-41H,1,25,27-29H2,2-4H3,(H,46,50)(H,47,49)/t30?,31?,38?,40-,41+/m1/s1 |
| InChIKey | QTPDWDWGJHIMLR-MPNZQHIVSA-N |
| XLogP | 6.89 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.86 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|