C55H70N3O2P — CID 138911186
2-bis(3,5-ditert-butylphenyl)phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide (PubChem CID 138911186) has the molecular formula C55H70N3O2P and a molecular weight of 836.16 g/mol. Its IUPAC name is 2-bis(3,5-ditert-butylphenyl)phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide.
| Compound Name | 2-bis(3,5-ditert-butylphenyl)phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 138911186 |
| Molecular Formula | C55H70N3O2P |
| Molecular Weight | 836.16 g/mol |
| Exact Mass | 835.52 |
| IUPAC Name | 2-bis(3,5-ditert-butylphenyl)phosphanyl-N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]benzamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NC(=O)c1ccccc1P(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C55H70N3O2P/c1-15-35-34-58-25-23-36(35)26-48(58)50(44-22-24-56-47-21-20-41(60-14)33-46(44)47)57-51(59)45-18-16-17-19-49(45)61(42-29-37(52(2,3)4)27-38(30-42)53(5,6)7)43-31-39(54(8,9)10)28-40(32-43)55(11,12)13/h15-22,24,27-33,35-36,48,50H,1,23,25-26,34H2,2-14H3,(H,57,59)/t35?,36?,48?,50-/m0/s1 |
| InChIKey | QZNIOMHCGNGSDF-JOIVQQGZSA-N |
| XLogP | 11.56 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.16 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|