C32H34N3O2P — CID 46914134
(1S)-N-diphenylphosphoryl-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-(6-methoxyquinolin-4-yl)methanamine (PubChem CID 46914134) has the molecular formula C32H34N3O2P and a molecular weight of 523.62 g/mol. Its IUPAC name is (1S)-N-diphenylphosphoryl-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-(6-methoxyquinolin-4-yl)methanamine.
| Compound Name | (1S)-N-diphenylphosphoryl-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-(6-methoxyquinolin-4-yl)methanamine |
|---|---|
| PubChem CID | 46914134 |
| Molecular Formula | C32H34N3O2P |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (1S)-N-diphenylphosphoryl-1-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-1-(6-methoxyquinolin-4-yl)methanamine |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C32H34N3O2P/c1-3-23-22-35-19-17-24(23)20-31(35)32(28-16-18-33-30-15-14-25(37-2)21-29(28)30)34-38(36,26-10-6-4-7-11-26)27-12-8-5-9-13-27/h3-16,18,21,23-24,31-32H,1,17,19-20,22H2,2H3,(H,34,36)/t23-,24-,31+,32-/m0/s1 |
| InChIKey | IFCSAIUNYJAHQA-XGAXUMQWSA-N |
| XLogP | 5.70 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|