C32H34N4O3 — CID 132528426
3-[[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-[[(1S)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 132528426) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 3-[[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-[[(1S)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-[[(1S)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 132528426 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-[[(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-[[(1S)-1-phenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C=CC1CN2CCC1CC2C(Nc1c(N[C@@H](C)c2ccccc2)c(=O)c1=O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C32H34N4O3/c1-4-20-18-36-15-13-22(20)16-27(36)28(24-12-14-33-26-11-10-23(39-3)17-25(24)26)35-30-29(31(37)32(30)38)34-19(2)21-8-6-5-7-9-21/h4-12,14,17,19-20,22,27-28,34-35H,1,13,15-16,18H2,2-3H3/t19-,20?,22?,27?,28?/m0/s1 |
| InChIKey | DFBIBTFBRDOEQS-FJABJWNFSA-N |
| XLogP | 5.06 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|