C30H29FN4O3 — CID 139255981
3-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-(4-fluoroanilino)cyclobut-3-ene-1,2-dione (PubChem CID 139255981) has the molecular formula C30H29FN4O3 and a molecular weight of 512.59 g/mol. Its IUPAC name is 3-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-(4-fluoroanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-(4-fluoroanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 139255981 |
| Molecular Formula | C30H29FN4O3 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 3-[[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]amino]-4-(4-fluoroanilino)cyclobut-3-ene-1,2-dione |
| SMILES | C=CC1CN2CCC1CC2[C@H](Nc1c(Nc2ccc(F)cc2)c(=O)c1=O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C30H29FN4O3/c1-3-17-16-35-13-11-18(17)14-25(35)26(22-10-12-32-24-9-8-21(38-2)15-23(22)24)34-28-27(29(36)30(28)37)33-20-6-4-19(31)5-7-20/h3-10,12,15,17-18,25-26,33-34H,1,11,13-14,16H2,2H3/t17?,18?,25?,26-/m1/s1 |
| InChIKey | ZAXMGKFYYHXDMY-VLVPZGBMSA-N |
| XLogP | 4.77 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|