C32H27F6N3O3 — CID 102050376
3-[3,5-bis(trifluoromethyl)phenyl]-4-[[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 102050376) has the molecular formula C32H27F6N3O3 and a molecular weight of 615.57 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-4-[[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-4-[[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 102050376 |
| Molecular Formula | C32H27F6N3O3 |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-4-[[(R)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](Nc1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(=O)c1=O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C32H27F6N3O3/c1-3-16-15-41-9-7-17(16)12-25(41)27(22-6-8-39-24-5-4-21(44-2)14-23(22)24)40-28-26(29(42)30(28)43)18-10-19(31(33,34)35)13-20(11-18)32(36,37)38/h3-6,8,10-11,13-14,16-17,25,27,40H,1,7,9,12,15H2,2H3/t16-,17-,25+,27+/m0/s1 |
| InChIKey | MAJJJADMPAFCCG-NKFGGQSZSA-N |
| XLogP | 6.59 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|