C30H28N2O2 — CID 101257287
2-[2-[(2-hydroxy-1,2-diphenylethylidene)amino]ethylimino]-1,2-diphenylethanol (PubChem CID 101257287) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-[2-[(2-hydroxy-1,2-diphenylethylidene)amino]ethylimino]-1,2-diphenylethanol.
| Compound Name | 2-[2-[(2-hydroxy-1,2-diphenylethylidene)amino]ethylimino]-1,2-diphenylethanol |
|---|---|
| PubChem CID | 101257287 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[2-[(2-hydroxy-1,2-diphenylethylidene)amino]ethylimino]-1,2-diphenylethanol |
| SMILES | OC(/C(=N\CC/N=C(\c1ccccc1)C(O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O2/c33-29(25-17-9-3-10-18-25)27(23-13-5-1-6-14-23)31-21-22-32-28(24-15-7-2-8-16-24)30(34)26-19-11-4-12-20-26/h1-20,29-30,33-34H,21-22H2/b31-27-,32-28+ |
| InChIKey | HYVJSJGEGFPFPT-GYNJYFOTSA-N |
| XLogP | 5.43 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|