C27H30ClN3O2 — CID 101258247
3-(4-chlorophenyl)-N-cyclohexyl-1-(2-methylpropyl)-6-oxo-5-phenylpyrazine-2-carboxamide (PubChem CID 101258247) has the molecular formula C27H30ClN3O2 and a molecular weight of 464.01 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-cyclohexyl-1-(2-methylpropyl)-6-oxo-5-phenylpyrazine-2-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-cyclohexyl-1-(2-methylpropyl)-6-oxo-5-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 101258247 |
| Molecular Formula | C27H30ClN3O2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 3-(4-chlorophenyl)-N-cyclohexyl-1-(2-methylpropyl)-6-oxo-5-phenylpyrazine-2-carboxamide |
| SMILES | CC(C)Cn1c(C(=O)NC2CCCCC2)c(-c2ccc(Cl)cc2)nc(-c2ccccc2)c1=O |
| InChI | InChI=1S/C27H30ClN3O2/c1-18(2)17-31-25(26(32)29-22-11-7-4-8-12-22)23(20-13-15-21(28)16-14-20)30-24(27(31)33)19-9-5-3-6-10-19/h3,5-6,9-10,13-16,18,22H,4,7-8,11-12,17H2,1-2H3,(H,29,32) |
| InChIKey | FCZGGAIRPYWIBX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |