C30H27ClN2O2 — CID 10950969
1-(4-chlorophenyl)-N-cyclohexyl-6-oxo-4,5-diphenylpyridine-2-carboxamide (PubChem CID 10950969) has the molecular formula C30H27ClN2O2 and a molecular weight of 483.01 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-cyclohexyl-6-oxo-4,5-diphenylpyridine-2-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-cyclohexyl-6-oxo-4,5-diphenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 10950969 |
| Molecular Formula | C30H27ClN2O2 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 1-(4-chlorophenyl)-N-cyclohexyl-6-oxo-4,5-diphenylpyridine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(-c2ccccc2)c(-c2ccccc2)c(=O)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H27ClN2O2/c31-23-16-18-25(19-17-23)33-27(29(34)32-24-14-8-3-9-15-24)20-26(21-10-4-1-5-11-21)28(30(33)35)22-12-6-2-7-13-22/h1-2,4-7,10-13,16-20,24H,3,8-9,14-15H2,(H,32,34) |
| InChIKey | RJQUZDSOXONOHT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |