C22H21Cl2N3O — CID 42759394
3-(2-chlorophenyl)-1-(3-chlorophenyl)-N-cyclohexylpyrazole-5-carboxamide (PubChem CID 42759394) has the molecular formula C22H21Cl2N3O and a molecular weight of 414.34 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(3-chlorophenyl)-N-cyclohexylpyrazole-5-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-1-(3-chlorophenyl)-N-cyclohexylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42759394 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(3-chlorophenyl)-N-cyclohexylpyrazole-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(-c2ccccc2Cl)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2N3O/c23-15-7-6-10-17(13-15)27-21(22(28)25-16-8-2-1-3-9-16)14-20(26-27)18-11-4-5-12-19(18)24/h4-7,10-14,16H,1-3,8-9H2,(H,25,28) |
| InChIKey | SOBSCRNBNZXZLP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |