C24H26N4O3 — CID 3993041
N-cyclohexyl-3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 3993041) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-cyclohexyl-3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | N-cyclohexyl-3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3993041 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-cyclohexyl-3-(3,4-dimethylphenyl)-1-(3-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NC3CCCCC3)n(-c3cccc([N+](=O)[O-])c3)n2)cc1C |
| InChI | InChI=1S/C24H26N4O3/c1-16-11-12-18(13-17(16)2)22-15-23(24(29)25-19-7-4-3-5-8-19)27(26-22)20-9-6-10-21(14-20)28(30)31/h6,9-15,19H,3-5,7-8H2,1-2H3,(H,25,29) |
| InChIKey | NKPSETRDEPMTMW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|