C22H22ClN3O — CID 4521775
3-(2-chlorophenyl)-N-cyclohexyl-1-phenylpyrazole-5-carboxamide (PubChem CID 4521775) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-cyclohexyl-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-cyclohexyl-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4521775 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-(2-chlorophenyl)-N-cyclohexyl-1-phenylpyrazole-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(-c2ccccc2Cl)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H22ClN3O/c23-19-14-8-7-13-18(19)20-15-21(22(27)24-16-9-3-1-4-10-16)26(25-20)17-11-5-2-6-12-17/h2,5-8,11-16H,1,3-4,9-10H2,(H,24,27) |
| InChIKey | RXLTYUPUTGSZDX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |