C31H52O6 — CID 101262422
(1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(E,4S)-4,5-dihydroxy-6-methoxy-6-methylhept-2-en-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol (PubChem CID 101262422) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is (1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(E,4S)-4,5-dihydroxy-6-methoxy-6-methylhept-2-en-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol.
| Compound Name | (1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(E,4S)-4,5-dihydroxy-6-methoxy-6-methylhept-2-en-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol |
|---|---|
| PubChem CID | 101262422 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | (1R,2S,3R,5R,6S,9R,10R,13R,15S)-6-[(E,4S)-4,5-dihydroxy-6-methoxy-6-methylhept-2-en-2-yl]-9,10,14,14-tetramethyl-16-oxapentacyclo[13.2.2.01,13.02,10.05,9]nonadecane-3,15-diol |
| SMILES | COC(C)(C)C(O)[C@@H](O)/C=C(\C)[C@H]1CC[C@]2(C)[C@@H]1C[C@@H](O)[C@@H]1[C@]34CC[C@](O)(OC3)C(C)(C)[C@@H]4CC[C@]12C |
| InChI | InChI=1S/C31H52O6/c1-18(15-22(33)25(34)27(4,5)36-8)19-9-11-28(6)20(19)16-21(32)24-29(28,7)12-10-23-26(2,3)31(35)14-13-30(23,24)17-37-31/h15,19-25,32-35H,9-14,16-17H2,1-8H3/b18-15+/t19-,20-,21-,22+,23+,24+,25?,28-,29-,30-,31+/m1/s1 |
| InChIKey | ANFJBMXRWPPYJK-XYWGIZNISA-N |
| XLogP | 4.43 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|