C21H24N4O5 — CID 101263152
6-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-N-(6-acetamido-2-pyridinyl)hexanamide (PubChem CID 101263152) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 6-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-N-(6-acetamido-2-pyridinyl)hexanamide.
| Compound Name | 6-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-N-(6-acetamido-2-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 101263152 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 6-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-N-(6-acetamido-2-pyridinyl)hexanamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CCCCCN2C(=O)[C@@H]3C4C=CC(O4)[C@@H]3C2=O)n1 |
| InChI | InChI=1S/C21H24N4O5/c1-12(26)22-15-6-5-7-16(23-15)24-17(27)8-3-2-4-11-25-20(28)18-13-9-10-14(30-13)19(18)21(25)29/h5-7,9-10,13-14,18-19H,2-4,8,11H2,1H3,(H2,22,23,24,26,27)/t13?,14?,18-,19+ |
| InChIKey | ZXIJEOLAYXXHII-FZGXFMPJSA-N |
| XLogP | 1.48 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|