C27H22N2O3 — CID 101263910
(3,3-dimethyl-2-naphthalen-2-yl-2H-indol-1-yl)-(4-nitrophenyl)methanone (PubChem CID 101263910) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is (3,3-dimethyl-2-naphthalen-2-yl-2H-indol-1-yl)-(4-nitrophenyl)methanone.
| Compound Name | (3,3-dimethyl-2-naphthalen-2-yl-2H-indol-1-yl)-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 101263910 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (3,3-dimethyl-2-naphthalen-2-yl-2H-indol-1-yl)-(4-nitrophenyl)methanone |
| SMILES | CC1(C)c2ccccc2N(C(=O)c2ccc([N+](=O)[O-])cc2)C1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H22N2O3/c1-27(2)23-9-5-6-10-24(23)28(26(30)19-13-15-22(16-14-19)29(31)32)25(27)21-12-11-18-7-3-4-8-20(18)17-21/h3-17,25H,1-2H3 |
| InChIKey | ANYKOAXLTAMDDL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|