C33H35N3O4S — CID 101265944
tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanethioyl]amino]propanoate (PubChem CID 101265944) has the molecular formula C33H35N3O4S and a molecular weight of 569.73 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanethioyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanethioyl]amino]propanoate |
|---|---|
| PubChem CID | 101265944 |
| Molecular Formula | C33H35N3O4S |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)propanethioyl]amino]propanoate |
| SMILES | C[C@H](NC(=S)[C@H](Cc1c[nH]c2ccccc12)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H35N3O4S/c1-20(31(37)40-33(2,3)4)35-30(41)29(17-21-18-34-28-16-10-9-11-22(21)28)36-32(38)39-19-27-25-14-7-5-12-23(25)24-13-6-8-15-26(24)27/h5-16,18,20,27,29,34H,17,19H2,1-4H3,(H,35,41)(H,36,38)/t20-,29-/m0/s1 |
| InChIKey | AOVKQSPSLXCPEP-WRONEBCDSA-N |
| XLogP | 6.26 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|