C18H30O7S — CID 101267910
S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-pentyl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate (PubChem CID 101267910) has the molecular formula C18H30O7S and a molecular weight of 390.50 g/mol. Its IUPAC name is S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-pentyl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate.
| Compound Name | S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-pentyl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
|---|---|
| PubChem CID | 101267910 |
| Molecular Formula | C18H30O7S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-pentyl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
| SMILES | CCCCC[C@H]1OC(=O)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@]12C(=O)SCC |
| InChI | InChI=1S/C18H30O7S/c1-7-9-10-11-12-18(15(20)26-8-2)13(14(19)23-12)24-16(3,21-5)17(4,22-6)25-18/h12-13H,7-11H2,1-6H3/t12-,13+,16-,17-,18-/m1/s1 |
| InChIKey | UCTFWSWTPBUHCS-KQIDPQQZSA-N |
| XLogP | 2.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|