C16H26O7S — CID 11439868
S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-propan-2-yl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate (PubChem CID 11439868) has the molecular formula C16H26O7S and a molecular weight of 362.44 g/mol. Its IUPAC name is S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-propan-2-yl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate.
| Compound Name | S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-propan-2-yl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
|---|---|
| PubChem CID | 11439868 |
| Molecular Formula | C16H26O7S |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | S-ethyl (2R,3R,4aR,5R,7aR)-2,3-dimethoxy-2,3-dimethyl-7-oxo-5-propan-2-yl-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
| SMILES | CCSC(=O)[C@]12O[C@@](C)(OC)[C@](C)(OC)O[C@H]1C(=O)O[C@@H]2C(C)C |
| InChI | InChI=1S/C16H26O7S/c1-8-24-13(18)16-10(9(2)3)21-12(17)11(16)22-14(4,19-6)15(5,20-7)23-16/h9-11H,8H2,1-7H3/t10-,11+,14-,15-,16-/m1/s1 |
| InChIKey | GDRQOCLGQQIRSI-LZYVBGRKSA-N |
| XLogP | 1.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|