C15H24O7S — CID 11382465
S-ethyl (2R,3R,4aR,5R,7aR)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate (PubChem CID 11382465) has the molecular formula C15H24O7S and a molecular weight of 348.42 g/mol. Its IUPAC name is S-ethyl (2R,3R,4aR,5R,7aR)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate.
| Compound Name | S-ethyl (2R,3R,4aR,5R,7aR)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
|---|---|
| PubChem CID | 11382465 |
| Molecular Formula | C15H24O7S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | S-ethyl (2R,3R,4aR,5R,7aR)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-7-oxo-5,7a-dihydrofuro[3,4-b][1,4]dioxine-4a-carbothioate |
| SMILES | CCSC(=O)[C@]12O[C@@](C)(OC)[C@](C)(OC)O[C@H]1C(=O)O[C@@H]2CC |
| InChI | InChI=1S/C15H24O7S/c1-7-9-15(12(17)23-8-2)10(11(16)20-9)21-13(3,18-5)14(4,19-6)22-15/h9-10H,7-8H2,1-6H3/t9-,10+,13-,14-,15-/m1/s1 |
| InChIKey | ZCCJVEJFBFBYSC-QFWNWRTJSA-N |
| XLogP | 1.48 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|