C14H21NO3 — CID 101268290
3-hydroxy-5-methoxy-N,N-dipropylbenzamide (PubChem CID 101268290) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-hydroxy-5-methoxy-N,N-dipropylbenzamide.
| Compound Name | 3-hydroxy-5-methoxy-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 101268290 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-hydroxy-5-methoxy-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cc(O)cc(OC)c1 |
| InChI | InChI=1S/C14H21NO3/c1-4-6-15(7-5-2)14(17)11-8-12(16)10-13(9-11)18-3/h8-10,16H,4-7H2,1-3H3 |
| InChIKey | XNIPUKXIYCBUIL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |