C18H31NO2 — CID 142843916
ethane;3-ethyl-5-methoxy-N,N-dipropylbenzamide (PubChem CID 142843916) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is ethane;3-ethyl-5-methoxy-N,N-dipropylbenzamide.
| Compound Name | ethane;3-ethyl-5-methoxy-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 142843916 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | ethane;3-ethyl-5-methoxy-N,N-dipropylbenzamide |
| SMILES | CC.CCCN(CCC)C(=O)c1cc(CC)cc(OC)c1 |
| InChI | InChI=1S/C16H25NO2.C2H6/c1-5-8-17(9-6-2)16(18)14-10-13(7-3)11-15(12-14)19-4;1-2/h10-12H,5-9H2,1-4H3;1-2H3 |
| InChIKey | GMJPXYVHFQUTKZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |