C24H32N2O3S4 — CID 101268907
benzyl-[2-[2-[2-[2-[benzyl(dithiocarboxy)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamodithioic acid (PubChem CID 101268907) has the molecular formula C24H32N2O3S4 and a molecular weight of 524.80 g/mol. Its IUPAC name is benzyl-[2-[2-[2-[2-[benzyl(dithiocarboxy)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamodithioic acid.
| Compound Name | benzyl-[2-[2-[2-[2-[benzyl(dithiocarboxy)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamodithioic acid |
|---|---|
| PubChem CID | 101268907 |
| Molecular Formula | C24H32N2O3S4 |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | benzyl-[2-[2-[2-[2-[benzyl(dithiocarboxy)amino]ethoxy]ethoxy]ethoxy]ethyl]carbamodithioic acid |
| SMILES | S=C(S)N(CCOCCOCCOCCN(Cc1ccccc1)C(=S)S)Cc1ccccc1 |
| InChI | InChI=1S/C24H32N2O3S4/c30-23(31)25(19-21-7-3-1-4-8-21)11-13-27-15-17-29-18-16-28-14-12-26(24(32)33)20-22-9-5-2-6-10-22/h1-10H,11-20H2,(H,30,31)(H,32,33) |
| InChIKey | RPOFGZHXQNRZPN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|