C20H16O — CID 101270243
(E)-1-cyclopenta-2,4-dien-1-yl-3-(3-phenylphenyl)prop-2-en-1-one (PubChem CID 101270243) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is (E)-1-cyclopenta-2,4-dien-1-yl-3-(3-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-cyclopenta-2,4-dien-1-yl-3-(3-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 101270243 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (E)-1-cyclopenta-2,4-dien-1-yl-3-(3-phenylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(-c2ccccc2)c1)C1C=CC=C1 |
| InChI | InChI=1S/C20H16O/c21-20(18-10-4-5-11-18)14-13-16-7-6-12-19(15-16)17-8-2-1-3-9-17/h1-15,18H/b14-13+ |
| InChIKey | QMIAFNUZYSOQNU-BUHFOSPRSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|