C26H23BrN6O2 — CID 136610527
N-[N-[3-(3-bromophenyl)prop-2-enoyl]-N'-(diaminomethylideneamino)carbamimidoyl]-3-(3-phenylphenyl)prop-2-enamide (PubChem CID 136610527) has the molecular formula C26H23BrN6O2 and a molecular weight of 531.41 g/mol. Its IUPAC name is N-[N-[3-(3-bromophenyl)prop-2-enoyl]-N'-(diaminomethylideneamino)carbamimidoyl]-3-(3-phenylphenyl)prop-2-enamide.
| Compound Name | N-[N-[3-(3-bromophenyl)prop-2-enoyl]-N'-(diaminomethylideneamino)carbamimidoyl]-3-(3-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 136610527 |
| Molecular Formula | C26H23BrN6O2 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | N-[N-[3-(3-bromophenyl)prop-2-enoyl]-N'-(diaminomethylideneamino)carbamimidoyl]-3-(3-phenylphenyl)prop-2-enamide |
| SMILES | NC(N)=NN=C(NC(=O)C=Cc1cccc(Br)c1)NC(=O)C=Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H23BrN6O2/c27-22-11-5-7-19(17-22)13-15-24(35)31-26(33-32-25(28)29)30-23(34)14-12-18-6-4-10-21(16-18)20-8-2-1-3-9-20/h1-17H,(H4,28,29,32)(H2,30,31,33,34,35) |
| InChIKey | BBMFSTVQCYCWHD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|