C25H41NO2S — CID 10127035
2-decoxy-6-octyl-5H-thieno[2,3-b]pyridin-4-one (PubChem CID 10127035) has the molecular formula C25H41NO2S and a molecular weight of 419.68 g/mol. Its IUPAC name is 2-decoxy-6-octyl-5H-thieno[2,3-b]pyridin-4-one.
| Compound Name | 2-decoxy-6-octyl-5H-thieno[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 10127035 |
| Molecular Formula | C25H41NO2S |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 2-decoxy-6-octyl-5H-thieno[2,3-b]pyridin-4-one |
| SMILES | CCCCCCCCCCOc1cc2c(s1)N=C(CCCCCCCC)CC2=O |
| InChI | InChI=1S/C25H41NO2S/c1-3-5-7-9-11-12-14-16-18-28-24-20-22-23(27)19-21(26-25(22)29-24)17-15-13-10-8-6-4-2/h20H,3-19H2,1-2H3 |
| InChIKey | ZZMWEYRPVHIQBT-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|