C20H31NO3S — CID 21030703
2-hexoxy-6-octylthieno[2,3-d][1,3]oxazin-4-one (PubChem CID 21030703) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is 2-hexoxy-6-octylthieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-hexoxy-6-octylthieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 21030703 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-hexoxy-6-octylthieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCCCCCCc1cc2c(=O)oc(OCCCCCC)nc2s1 |
| InChI | InChI=1S/C20H31NO3S/c1-3-5-7-9-10-11-13-16-15-17-18(25-16)21-20(24-19(17)22)23-14-12-8-6-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | ODSGVODUNJLSFY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|