C15H21NO3S — CID 22053905
5-methyl-2-octoxythieno[2,3-d][1,3]oxazin-4-one (PubChem CID 22053905) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 5-methyl-2-octoxythieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 5-methyl-2-octoxythieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 22053905 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 5-methyl-2-octoxythieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCCCCCCOc1nc2scc(C)c2c(=O)o1 |
| InChI | InChI=1S/C15H21NO3S/c1-3-4-5-6-7-8-9-18-15-16-13-12(14(17)19-15)11(2)10-20-13/h10H,3-9H2,1-2H3 |
| InChIKey | HPOBXXPZWBHMIZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|