C24H38N2O4S — CID 21030738
5-methyl-2-octoxy-N-octyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxamide (PubChem CID 21030738) has the molecular formula C24H38N2O4S and a molecular weight of 450.65 g/mol. Its IUPAC name is 5-methyl-2-octoxy-N-octyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxamide.
| Compound Name | 5-methyl-2-octoxy-N-octyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 21030738 |
| Molecular Formula | C24H38N2O4S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 5-methyl-2-octoxy-N-octyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1sc2nc(OCCCCCCCC)oc(=O)c2c1C |
| InChI | InChI=1S/C24H38N2O4S/c1-4-6-8-10-12-14-16-25-21(27)20-18(3)19-22(31-20)26-24(30-23(19)28)29-17-15-13-11-9-7-5-2/h4-17H2,1-3H3,(H,25,27) |
| InChIKey | OPJKQEBKLHKSSP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|