C15H20N2O4S — CID 22053913
2-(heptylamino)-5-methyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylic acid (PubChem CID 22053913) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-(heptylamino)-5-methyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylic acid.
| Compound Name | 2-(heptylamino)-5-methyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylic acid |
|---|---|
| PubChem CID | 22053913 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(heptylamino)-5-methyl-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylic acid |
| SMILES | CCCCCCCNc1nc2sc(C(=O)O)c(C)c2c(=O)o1 |
| InChI | InChI=1S/C15H20N2O4S/c1-3-4-5-6-7-8-16-15-17-12-10(14(20)21-15)9(2)11(22-12)13(18)19/h3-8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | SCQDEDVCGGYRDS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|