C13H16N2O2 — CID 72702661
2-(pentylamino)-3,1-benzoxazin-4-one (PubChem CID 72702661) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-(pentylamino)-3,1-benzoxazin-4-one.
| Compound Name | 2-(pentylamino)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 72702661 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-(pentylamino)-3,1-benzoxazin-4-one |
| SMILES | CCCCCNc1nc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C13H16N2O2/c1-2-3-6-9-14-13-15-11-8-5-4-7-10(11)12(16)17-13/h4-5,7-8H,2-3,6,9H2,1H3,(H,14,15) |
| InChIKey | VSFSWRDHPLDUQB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|