C14H13F3N2O3 — CID 102236311
2-(butylamino)-6-(2,2,2-trifluoroacetyl)-3,1-benzoxazin-4-one (PubChem CID 102236311) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(butylamino)-6-(2,2,2-trifluoroacetyl)-3,1-benzoxazin-4-one.
| Compound Name | 2-(butylamino)-6-(2,2,2-trifluoroacetyl)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 102236311 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(butylamino)-6-(2,2,2-trifluoroacetyl)-3,1-benzoxazin-4-one |
| SMILES | CCCCNc1nc2ccc(C(=O)C(F)(F)F)cc2c(=O)o1 |
| InChI | InChI=1S/C14H13F3N2O3/c1-2-3-6-18-13-19-10-5-4-8(11(20)14(15,16)17)7-9(10)12(21)22-13/h4-5,7H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | IYCWIQWFVWRURF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|