C15H20N2O2 — CID 54169928
2-(heptylamino)-3,1-benzoxazin-4-one (PubChem CID 54169928) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(heptylamino)-3,1-benzoxazin-4-one.
| Compound Name | 2-(heptylamino)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 54169928 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-(heptylamino)-3,1-benzoxazin-4-one |
| SMILES | CCCCCCCNc1nc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-3-4-5-8-11-16-15-17-13-10-7-6-9-12(13)14(18)19-15/h6-7,9-10H,2-5,8,11H2,1H3,(H,16,17) |
| InChIKey | OUHJVRISNRTQPU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|