C12H13ClN2O2 — CID 42695236
2-(butylamino)-6-chloro-3,1-benzoxazin-4-one (PubChem CID 42695236) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-(butylamino)-6-chloro-3,1-benzoxazin-4-one.
| Compound Name | 2-(butylamino)-6-chloro-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 42695236 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-(butylamino)-6-chloro-3,1-benzoxazin-4-one |
| SMILES | CCCCNc1nc2ccc(Cl)cc2c(=O)o1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-2-3-6-14-12-15-10-5-4-8(13)7-9(10)11(16)17-12/h4-5,7H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | BPZMLLWAHJEZPG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|