C26H35N3O3S — CID 21030726
5-methyl-2-(octylamino)-4-oxo-N-(4-phenylbutyl)thieno[2,3-d][1,3]oxazine-6-carboxamide (PubChem CID 21030726) has the molecular formula C26H35N3O3S and a molecular weight of 469.65 g/mol. Its IUPAC name is 5-methyl-2-(octylamino)-4-oxo-N-(4-phenylbutyl)thieno[2,3-d][1,3]oxazine-6-carboxamide.
| Compound Name | 5-methyl-2-(octylamino)-4-oxo-N-(4-phenylbutyl)thieno[2,3-d][1,3]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 21030726 |
| Molecular Formula | C26H35N3O3S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 5-methyl-2-(octylamino)-4-oxo-N-(4-phenylbutyl)thieno[2,3-d][1,3]oxazine-6-carboxamide |
| SMILES | CCCCCCCCNc1nc2sc(C(=O)NCCCCc3ccccc3)c(C)c2c(=O)o1 |
| InChI | InChI=1S/C26H35N3O3S/c1-3-4-5-6-7-12-18-28-26-29-24-21(25(31)32-26)19(2)22(33-24)23(30)27-17-13-11-16-20-14-9-8-10-15-20/h8-10,14-15H,3-7,11-13,16-18H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | MMPIVQRFIGXZHH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|