C20H29NO5S — CID 21030804
octyl 5-methyl-2-(2-methylpropoxy)-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylate (PubChem CID 21030804) has the molecular formula C20H29NO5S and a molecular weight of 395.52 g/mol. Its IUPAC name is octyl 5-methyl-2-(2-methylpropoxy)-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylate.
| Compound Name | octyl 5-methyl-2-(2-methylpropoxy)-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylate |
|---|---|
| PubChem CID | 21030804 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | octyl 5-methyl-2-(2-methylpropoxy)-4-oxothieno[2,3-d][1,3]oxazine-6-carboxylate |
| SMILES | CCCCCCCCOC(=O)c1sc2nc(OCC(C)C)oc(=O)c2c1C |
| InChI | InChI=1S/C20H29NO5S/c1-5-6-7-8-9-10-11-24-19(23)16-14(4)15-17(27-16)21-20(26-18(15)22)25-12-13(2)3/h13H,5-12H2,1-4H3 |
| InChIKey | YJSSNCLJNXBSKQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|